Products 1951439-45-4

CAS 1951439-45-4 appears in our catalog under these names: 2,5-Dichloropyridin-4-amine hydrochloride, 2,5-Dichloro-pyridin-4-ylamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,5-dichloropyridin-4-amine;hydrochloride (CAS 1951439-45-4) is a chemical compound with the molecular formula C5H5Cl3N2 and a molecular weight of 199.46 g/mol. IUPAC name: 2,5-dichloropyridin-4-amine;hydrochloride. InChIKey: WNGUDDCMGHLESE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5Cl3N2
Molecular weight199.46 g/mol
IUPAC name2,5-dichloropyridin-4-amine;hydrochloride
InChIKeyWNGUDDCMGHLESE-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1Cl)Cl)N.Cl

Computed by PubChem (NCBI)