CAS 1951439-48-7 is the registry number for 1-tert-Butyl 2-(4-chlorophenyl)methyl pyrrole-1,2-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate (CAS 1951439-48-7) is a chemical compound with the molecular formula C17H18ClNO4 and a molecular weight of 335.8 g/mol. IUPAC name: 1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate. InChIKey: ZVWSVEQQFZWMIB-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO4 |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate |
| InChIKey | ZVWSVEQQFZWMIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC=C1C(=O)OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)