Products 1951439-48-7

CAS 1951439-48-7 is the registry number for 1-tert-Butyl 2-(4-chlorophenyl)methyl pyrrole-1,2-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate (CAS 1951439-48-7) is a chemical compound with the molecular formula C17H18ClNO4 and a molecular weight of 335.8 g/mol. IUPAC name: 1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate. InChIKey: ZVWSVEQQFZWMIB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18ClNO4
Molecular weight335.8 g/mol
IUPAC name1-O-tert-butyl 2-O-[(4-chlorophenyl)methyl] pyrrole-1,2-dicarboxylate
InChIKeyZVWSVEQQFZWMIB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=CC=C1C(=O)OCC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)