Products 1951439-62-5
CAS 1951439-62-5 appears in our catalog under these names: 4,5-Dibromo-2-(methoxycarbonyl)benzoic acid, 95%, 4,5-Dibromo-2-(methoxycarbonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4,5-dibromo-2-methoxycarbonylbenzoic acid (CAS 1951439-62-5) is a chemical compound with the molecular formula C9H6Br2O4 and a molecular weight of 337.95 g/mol. IUPAC name: 4,5-dibromo-2-methoxycarbonylbenzoic acid. InChIKey: UNFQAXRTTPARHF-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O4 |
|---|---|
| Molecular weight | 337.95 g/mol |
| IUPAC name | 4,5-dibromo-2-methoxycarbonylbenzoic acid |
| InChIKey | UNFQAXRTTPARHF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)