CAS 1951439-63-6 appears in our catalog under these names: 8-Iodo-6-nitro-imidazo[1,2-a]pyridine hydrochloride, 95%, 8-IOdo-6-nitro-imidazo(1,2-a)pyridine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
8-iodo-6-nitroimidazo[1,2-a]pyridine;hydrochloride (CAS 1951439-63-6) is a chemical compound with the molecular formula C7H5ClIN3O2 and a molecular weight of 325.49 g/mol. IUPAC name: 8-iodo-6-nitroimidazo[1,2-a]pyridine;hydrochloride. InChIKey: OLIKYTYSLMAWMN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3O2 |
|---|---|
| Molecular weight | 325.49 g/mol |
| IUPAC name | 8-iodo-6-nitroimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | OLIKYTYSLMAWMN-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)I)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)