CAS 1951439-71-6 is the registry number for 6-Trifluoromethyl-benzothiazol-2-ylamine acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
Acetic acid;6-(trifluoromethyl)-1,3-benzothiazol-2-amine (CAS 1951439-71-6) is a chemical compound with the molecular formula C10H9F3N2O2S and a molecular weight of 278.25 g/mol. IUPAC name: acetic acid;6-(trifluoromethyl)-1,3-benzothiazol-2-amine. InChIKey: CYNLUKCYCOEDQO-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2O2S |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | acetic acid;6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| InChIKey | CYNLUKCYCOEDQO-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CC2=C(C=C1C(F)(F)F)SC(=N2)N |
Computed by PubChem (NCBI)