CAS 1951439-99-8 is the registry number for N-{1-[(4-Fluorobenzene)sulfonyl]piperidin-3-yl}-3-phenylpropanamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-3-phenylpropanamide (CAS 1951439-99-8) is a chemical compound with the molecular formula C20H23FN2O3S and a molecular weight of 390.5 g/mol. IUPAC name: N-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-3-phenylpropanamide. InChIKey: JESLSQXVSJEUFE-UHFFFAOYSA-N.
| Molecular formula | C20H23FN2O3S |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | N-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-3-phenylpropanamide |
| InChIKey | JESLSQXVSJEUFE-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)F)NC(=O)CCC3=CC=CC=C3 |
Computed by PubChem (NCBI)