Products 1951440-00-8

CAS 1951440-00-8 is the registry number for (3-Bromo-4-chlorocarbonyl-phenyl)-carbamic acid methyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl N-(3-bromo-4-carbonochloridoylphenyl)carbamate (CAS 1951440-00-8) is a chemical compound with the molecular formula C9H7BrClNO3 and a molecular weight of 292.51 g/mol. IUPAC name: methyl N-(3-bromo-4-carbonochloridoylphenyl)carbamate. InChIKey: ONIGFNBMQAWFBS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrClNO3
Molecular weight292.51 g/mol
IUPAC namemethyl N-(3-bromo-4-carbonochloridoylphenyl)carbamate
InChIKeyONIGFNBMQAWFBS-UHFFFAOYSA-N
SMILESCOC(=O)NC1=CC(=C(C=C1)C(=O)Cl)Br

Computed by PubChem (NCBI)