CAS 1951441-18-1 is the registry number for 1-(5-Fluoro-pyridin-2-yl)-[1,4]diazepane dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(5-fluoro-2-pyridinyl)-1,4-diazepane;dihydrochloride (CAS 1951441-18-1) is a chemical compound with the molecular formula C10H16Cl2FN3 and a molecular weight of 268.16 g/mol. IUPAC name: 1-(5-fluoro-2-pyridinyl)-1,4-diazepane;dihydrochloride. InChIKey: ZCRDLMYURVQVQV-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2FN3 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 1-(5-fluoro-2-pyridinyl)-1,4-diazepane;dihydrochloride |
| InChIKey | ZCRDLMYURVQVQV-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)F.Cl.Cl |
Computed by PubChem (NCBI)