CAS 1951441-81-8 appears in our catalog under these names: 2-(4-Chlorobenzo[d]oxazol-2-yl)acetic acid sodium salt, 95%, Sodium 2-(4-chlorobenzo(d)oxazol-2-yl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Sodium 2-(4-chloro-1,3-benzoxazol-2-yl)acetate (CAS 1951441-81-8) is a chemical compound with the molecular formula C9H5ClNNaO3 and a molecular weight of 233.58 g/mol. IUPAC name: sodium 2-(4-chloro-1,3-benzoxazol-2-yl)acetate. InChIKey: ATCVFFJHANCODZ-UHFFFAOYSA-M.
| Molecular formula | C9H5ClNNaO3 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | sodium 2-(4-chloro-1,3-benzoxazol-2-yl)acetate |
| InChIKey | ATCVFFJHANCODZ-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(O2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)