CAS 1951441-92-1 appears in our catalog under these names: 3,4,5-Tri(tert-butyl)bromobenzene, 95%, 3,4,5-Tri(tert-butyl)bromobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 10000mg.
5-bromo-1,2,3-tritert-butylbenzene (CAS 1951441-92-1) is a chemical compound with the molecular formula C18H29Br and a molecular weight of 325.3 g/mol. IUPAC name: 5-bromo-1,2,3-tritert-butylbenzene. InChIKey: BFSTYFYIECDFCT-UHFFFAOYSA-N.
| Molecular formula | C18H29Br |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 5-bromo-1,2,3-tritert-butylbenzene |
| InChIKey | BFSTYFYIECDFCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1C(C)(C)C)C(C)(C)C)Br |
Computed by PubChem (NCBI)