CAS 1951444-40-8 is the registry number for Cis-tert-butyl 3-hydroxy-4-methyl-3-(trifluoromethyl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
Tert-butyl (3R,4R)-3-hydroxy-4-methyl-3-(trifluoromethyl)piperidine-1-carboxylate (CAS 1951444-40-8) is a chemical compound with the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. IUPAC name: tert-butyl (3R,4R)-3-hydroxy-4-methyl-3-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: XNCBBXNFTMSZIV-KCJUWKMLSA-N.
| Molecular formula | C12H20F3NO3 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-hydroxy-4-methyl-3-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | XNCBBXNFTMSZIV-KCJUWKMLSA-N |
| SMILES | C[C@@H]1CCN(C[C@]1(C(F)(F)F)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)