Products 1951444-57-7

CAS 1951444-57-7 is the registry number for 4-Chloro-3-hydroxy-pyridine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-3-hydroxypyridine-2-carboxylic acid;hydrochloride (CAS 1951444-57-7) is a chemical compound with the molecular formula C6H5Cl2NO3 and a molecular weight of 210.01 g/mol. IUPAC name: 4-chloro-3-hydroxypyridine-2-carboxylic acid;hydrochloride. InChIKey: VLHHKLLSDTZWHR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl2NO3
Molecular weight210.01 g/mol
IUPAC name4-chloro-3-hydroxypyridine-2-carboxylic acid;hydrochloride
InChIKeyVLHHKLLSDTZWHR-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1Cl)O)C(=O)O.Cl

Computed by PubChem (NCBI)