CAS 1951444-77-1 appears in our catalog under these names: 2-Bromo-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine, 95%, 2-Bromo-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g.
2-bromo-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine (CAS 1951444-77-1) is a chemical compound with the molecular formula C8H5BrF3N3O and a molecular weight of 296.04 g/mol. IUPAC name: 2-bromo-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: SVYZUHSGVZDUDT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3N3O |
|---|---|
| Molecular weight | 296.04 g/mol |
| IUPAC name | 2-bromo-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | SVYZUHSGVZDUDT-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C(=C1)OCC(F)(F)F |
Computed by PubChem (NCBI)