CAS 1951444-80-6 is the registry number for 4-Benzyl-3-cyano-n-(thiazol-2-yl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
4-benzyl-3-cyano-N-(1,3-thiazol-2-yl)benzenesulfonamide (CAS 1951444-80-6) is a chemical compound with the molecular formula C17H13N3O2S2 and a molecular weight of 355.4 g/mol. IUPAC name: 4-benzyl-3-cyano-N-(1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: IPSPSTQMMQADNA-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2S2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 4-benzyl-3-cyano-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | IPSPSTQMMQADNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=C(C=C2)S(=O)(=O)NC3=NC=CS3)C#N |
Computed by PubChem (NCBI)