CAS 1951483-81-0 is the registry number for 2-(2-Chloropyrimidin-4-yl)-6,6-dimethyl-5,6-dihydro-4H-thieno[2,3-c]pyrrol-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloropyrimidin-4-yl)-6,6-dimethyl-5H-thieno[2,3-c]pyrrol-4-one (CAS 1951483-81-0) is a chemical compound with the molecular formula C12H10ClN3OS and a molecular weight of 279.75 g/mol. IUPAC name: 2-(2-chloropyrimidin-4-yl)-6,6-dimethyl-5H-thieno[2,3-c]pyrrol-4-one. InChIKey: GEGFMFLOPTVDJJ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3OS |
|---|---|
| Molecular weight | 279.75 g/mol |
| IUPAC name | 2-(2-chloropyrimidin-4-yl)-6,6-dimethyl-5H-thieno[2,3-c]pyrrol-4-one |
| InChIKey | GEGFMFLOPTVDJJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(S2)C3=NC(=NC=C3)Cl)C(=O)N1)C |
Computed by PubChem (NCBI)