Products 195157-34-7
CAS 195157-34-7 is the registry number for Valomaciclovir. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl] (2S)-2-amino-3-methylbutanoate (CAS 195157-34-7) is a chemical compound with the molecular formula C15H24N6O4 and a molecular weight of 352.39 g/mol. IUPAC name: [(3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl] (2S)-2-amino-3-methylbutanoate. InChIKey: ATSZELKUSAREPW-ZJUUUORDSA-N.
| Molecular formula | C15H24N6O4 |
|---|---|
| Molecular weight | 352.39 g/mol |
| IUPAC name | [(3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl] (2S)-2-amino-3-methylbutanoate |
| InChIKey | ATSZELKUSAREPW-ZJUUUORDSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC[C@H](CN1C=NC2=C1N=C(NC2=O)N)CO)N |
Computed by PubChem (NCBI)