CAS 1953133-33-9 is the registry number for 3-((tert-Butyldiphenylsilyl)oxy)-2,2-difluoropropan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol (CAS 1953133-33-9) is a chemical compound with the molecular formula C19H24F2O2Si and a molecular weight of 350.5 g/mol. IUPAC name: 3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol. InChIKey: DPTVIASBQRUVNA-UHFFFAOYSA-N.
| Molecular formula | C19H24F2O2Si |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | 3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol |
| InChIKey | DPTVIASBQRUVNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC(CO)(F)F |
Computed by PubChem (NCBI)