CAS 1953152-17-4 is the registry number for 8-(6-Fluoropyridin-2-yl)-4-methyldihydro-4l4,8l4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(6-fluoro-2-pyridinyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1953152-17-4) is a chemical compound with the molecular formula C10H10BFN2O4 and a molecular weight of 252.01 g/mol. IUPAC name: 2-(6-fluoro-2-pyridinyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: VUQBYUZQDOTCOG-UHFFFAOYSA-N.
| Molecular formula | C10H10BFN2O4 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 2-(6-fluoro-2-pyridinyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | VUQBYUZQDOTCOG-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=NC(=CC=C2)F |
Computed by PubChem (NCBI)