CAS 19542-05-3 appears in our catalog under these names: 2,5-Bis(4-bromophenyl)-1,3,4-oxadiazole, 98%, 98%, 2,5-Bis(4-bromophenyl)-1,3,4-oxadiazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-bis(4-bromophenyl)-1,3,4-oxadiazole (CAS 19542-05-3) is a chemical compound with the molecular formula C14H8Br2N2O and a molecular weight of 380.03 g/mol. IUPAC name: 2,5-bis(4-bromophenyl)-1,3,4-oxadiazole. InChIKey: HGPVZVIPOXMTJD-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2N2O |
|---|---|
| Molecular weight | 380.03 g/mol |
| IUPAC name | 2,5-bis(4-bromophenyl)-1,3,4-oxadiazole |
| InChIKey | HGPVZVIPOXMTJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)Br)Br |
Computed by PubChem (NCBI)