CAS 195503-20-9 appears in our catalog under these names: 17-trifluoromethylphenyl trinor Prostaglandin F2α methyl ester, 17–trifluoromethylphenyl trinor Prostaglandin F2α methyl ester, 17-Trifluoromethylphenyl trinor prostaglandin f2α methyl ester. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
Methyl 7-[3,5-dihydroxy-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enoate (CAS 195503-20-9) is a chemical compound with the molecular formula C25H33F3O5 and a molecular weight of 470.5 g/mol. IUPAC name: methyl 7-[3,5-dihydroxy-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enoate. InChIKey: SPNWWFJGYHYDNY-UHFFFAOYSA-N.
| Molecular formula | C25H33F3O5 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | methyl 7-[3,5-dihydroxy-2-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enoate |
| InChIKey | SPNWWFJGYHYDNY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC(=CC=C2)C(F)(F)F)O)O)O |
Computed by PubChem (NCBI)