Products 195526-67-1

CAS 195526-67-1 is the registry number for 2,2'-(Piperazine-1,4-dicarbonyl)dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[4-(2-carboxybenzoyl)piperazine-1-carbonyl]benzoic acid (CAS 195526-67-1) is a chemical compound with the molecular formula C20H18N2O6 and a molecular weight of 382.4 g/mol. IUPAC name: 2-[4-(2-carboxybenzoyl)piperazine-1-carbonyl]benzoic acid. InChIKey: GQKZKPFUFFDRPX-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18N2O6
Molecular weight382.4 g/mol
IUPAC name2-[4-(2-carboxybenzoyl)piperazine-1-carbonyl]benzoic acid
InChIKeyGQKZKPFUFFDRPX-UHFFFAOYSA-N
SMILESC1CN(CCN1C(=O)C2=CC=CC=C2C(=O)O)C(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)