Products 19553-26-5
CAS 19553-26-5 appears in our catalog under these names: rel-Isocyclopenine, Cyclopenin. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 2,5mg, 1mg, 5mg, Get quote.
(3S,3'S)-4-methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione (CAS 19553-26-5) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: (3S,3'S)-4-methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione. InChIKey: APLKWZASYUZSBL-YOEHRIQHSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | (3S,3'S)-4-methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione |
| InChIKey | APLKWZASYUZSBL-YOEHRIQHSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2NC(=O)[C@@]13[C@@H](O3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)