CAS 1955474-33-5 appears in our catalog under these names: (1R)–1–(Pyrazin–2–yl)ethan–1–amine dihydrochloride, (1R)-1-(Pyrazin-2-yl)ethan-1-amine dihydrochloride, (R)-1-(Pyrazin-2-yl)ethan-1-amine dihydrochloride, 95%, (1R)-1-(Pyrazin-2-yl)ethan-1-amine dihydrochloride, 95%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 100mg, 2,5g, 250mg, 1g.
(1R)-1-pyrazin-2-ylethanamine;dihydrochloride (CAS 1955474-33-5) is a chemical compound with the molecular formula C6H11Cl2N3 and a molecular weight of 196.07 g/mol. IUPAC name: (1R)-1-pyrazin-2-ylethanamine;dihydrochloride. InChIKey: DXTZMYLBMRESFK-ZJIMSODOSA-N.
| Molecular formula | C6H11Cl2N3 |
|---|---|
| Molecular weight | 196.07 g/mol |
| IUPAC name | (1R)-1-pyrazin-2-ylethanamine;dihydrochloride |
| InChIKey | DXTZMYLBMRESFK-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=NC=CN=C1)N.Cl.Cl |
Computed by PubChem (NCBI)