CAS 1955474-57-3 is the registry number for Methyl (2S,3R)-2-(ethylamino)-3-hydroxybutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2S,3R)-2-(ethylamino)-3-hydroxybutanoate (CAS 1955474-57-3) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. IUPAC name: methyl (2S,3R)-2-(ethylamino)-3-hydroxybutanoate. InChIKey: DMECLSVIFYXWID-RITPCOANSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | methyl (2S,3R)-2-(ethylamino)-3-hydroxybutanoate |
| InChIKey | DMECLSVIFYXWID-RITPCOANSA-N |
| SMILES | CCN[C@@H]([C@@H](C)O)C(=O)OC |
Computed by PubChem (NCBI)