Products 1955474-68-6
CAS 1955474-68-6 is the registry number for (3R,5S)-5-(Methoxymethyl)pyrrolidin-3-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,5S)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride (CAS 1955474-68-6) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: (3R,5S)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride. InChIKey: KNMOZBOMDXHCKW-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | (3R,5S)-5-(methoxymethyl)pyrrolidin-3-ol;hydrochloride |
| InChIKey | KNMOZBOMDXHCKW-RIHPBJNCSA-N |
| SMILES | COC[C@@H]1C[C@H](CN1)O.Cl |
Computed by PubChem (NCBI)