CAS 1955494-19-5 appears in our catalog under these names: rel-(2R,6R)-6-Methylmorpholine-2-carboxylic acid, 97%, rel-(2R,6R)-6-Methylmorpholine-2-carboxylic acid, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
(2R,6R)-6-methylmorpholine-2-carboxylic acid (CAS 1955494-19-5) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: (2R,6R)-6-methylmorpholine-2-carboxylic acid. InChIKey: PTEJYZZFUJQPJK-RFZPGFLSSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | (2R,6R)-6-methylmorpholine-2-carboxylic acid |
| InChIKey | PTEJYZZFUJQPJK-RFZPGFLSSA-N |
| SMILES | C[C@@H]1CNC[C@@H](O1)C(=O)O |
Computed by PubChem (NCBI)