CAS 1955494-25-3 is the registry number for Lithium 2-(2-cyanophenyl)-2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-(2-cyanophenyl)-2,2-difluoroacetate (CAS 1955494-25-3) is a chemical compound with the molecular formula C9H4F2LiNO2 and a molecular weight of 203.1 g/mol. IUPAC name: lithium 2-(2-cyanophenyl)-2,2-difluoroacetate. InChIKey: LMQFTTUYOOLACJ-UHFFFAOYSA-M.
| Molecular formula | C9H4F2LiNO2 |
|---|---|
| Molecular weight | 203.1 g/mol |
| IUPAC name | lithium 2-(2-cyanophenyl)-2,2-difluoroacetate |
| InChIKey | LMQFTTUYOOLACJ-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=C(C(=C1)C#N)C(C(=O)[O-])(F)F |
Computed by PubChem (NCBI)