Products 1955498-39-1
CAS 1955498-39-1 is the registry number for 7,8-Difluoro-3-nitroquinolin-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,8-difluoro-3-nitro-1H-quinolin-4-one (CAS 1955498-39-1) is a chemical compound with the molecular formula C9H4F2N2O3 and a molecular weight of 226.14 g/mol. IUPAC name: 7,8-difluoro-3-nitro-1H-quinolin-4-one. InChIKey: JZIVWOYVHCMPQN-UHFFFAOYSA-N.
| Molecular formula | C9H4F2N2O3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 7,8-difluoro-3-nitro-1H-quinolin-4-one |
| InChIKey | JZIVWOYVHCMPQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=CN2)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)