CAS 1955515-61-3 is the registry number for 4-Bromo-3-methyl-1-phenyl-1h-pyrazol-5-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide (CAS 1955515-61-3) is a chemical compound with the molecular formula C10H11Br2N3 and a molecular weight of 333.02 g/mol. IUPAC name: 4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide. InChIKey: NMCUPKZOMVOVQG-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2N3 |
|---|---|
| Molecular weight | 333.02 g/mol |
| IUPAC name | 4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide |
| InChIKey | NMCUPKZOMVOVQG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Br)N)C2=CC=CC=C2.Br |
Computed by PubChem (NCBI)