Products 1955515-61-3

CAS 1955515-61-3 is the registry number for 4-Bromo-3-methyl-1-phenyl-1h-pyrazol-5-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide (CAS 1955515-61-3) is a chemical compound with the molecular formula C10H11Br2N3 and a molecular weight of 333.02 g/mol. IUPAC name: 4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide. InChIKey: NMCUPKZOMVOVQG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11Br2N3
Molecular weight333.02 g/mol
IUPAC name4-bromo-3-methyl-1-phenylpyrazol-5-amine;hydrobromide
InChIKeyNMCUPKZOMVOVQG-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1Br)N)C2=CC=CC=C2.Br

Computed by PubChem (NCBI)