CAS 1955519-24-0 is the registry number for Rel-((1R,6R)-7,7-difluoro-2-oxabicyclo(4.1.0)heptan-1-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[(1R,6R)-7,7-difluoro-2-oxabicyclo[4.1.0]heptan-1-yl]methanamine;hydrochloride (CAS 1955519-24-0) is a chemical compound with the molecular formula C7H12ClF2NO and a molecular weight of 199.62 g/mol. IUPAC name: [(1R,6R)-7,7-difluoro-2-oxabicyclo[4.1.0]heptan-1-yl]methanamine;hydrochloride. InChIKey: KPFJJWBUZWKJEX-IBTYICNHSA-N.
| Molecular formula | C7H12ClF2NO |
|---|---|
| Molecular weight | 199.62 g/mol |
| IUPAC name | [(1R,6R)-7,7-difluoro-2-oxabicyclo[4.1.0]heptan-1-yl]methanamine;hydrochloride |
| InChIKey | KPFJJWBUZWKJEX-IBTYICNHSA-N |
| SMILES | C1C[C@@H]2[C@@](C2(F)F)(OC1)CN.Cl |
Computed by PubChem (NCBI)