Products 1955530-17-2

CAS 1955530-17-2 appears in our catalog under these names: 1,1-Difluorospiro(2.5)octan-6-amine hydrochloride, 1,1-Difluorospiro[2.5]octan-6-amine hydrochloride 95%, 1,1-Difluorospiro[2.5]octan-6-amine hydrochloride, 97%, 97%, 1,1-DIFLUOROSPIRO[2.5]OCTAN-6-AMINE HCL, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 10g, 100mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,2-difluorospiro[2.5]octan-6-amine;hydrochloride (CAS 1955530-17-2) is a chemical compound with the molecular formula C8H14ClF2N and a molecular weight of 197.65 g/mol. IUPAC name: 2,2-difluorospiro[2.5]octan-6-amine;hydrochloride. InChIKey: QCAZHLJSDLFFML-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClF2N
Molecular weight197.65 g/mol
IUPAC name2,2-difluorospiro[2.5]octan-6-amine;hydrochloride
InChIKeyQCAZHLJSDLFFML-UHFFFAOYSA-N
SMILESC1CC2(CCC1N)CC2(F)F.Cl

Computed by PubChem (NCBI)