CAS 1955540-09-6 appears in our catalog under these names: 1-((2,6-Difluorophenyl)methyl)-4-iodo-1H-1,2,3-triazole, 95%, 1-((2,6-Difluorophenyl)methyl)-4-iodo-1H-1,2,3-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(2,6-difluorophenyl)methyl]-4-iodotriazole (CAS 1955540-09-6) is a chemical compound with the molecular formula C9H6F2IN3 and a molecular weight of 321.07 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)methyl]-4-iodotriazole. InChIKey: PGFOHKJPAASKEV-UHFFFAOYSA-N.
| Molecular formula | C9H6F2IN3 |
|---|---|
| Molecular weight | 321.07 g/mol |
| IUPAC name | 1-[(2,6-difluorophenyl)methyl]-4-iodotriazole |
| InChIKey | PGFOHKJPAASKEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN2C=C(N=N2)I)F |
Computed by PubChem (NCBI)