CAS 1955540-74-5 is the registry number for tert-Butyl 7-(chlorosulfonyl)-2,3-dihydro-4H-benzo(b)(1,4)oxazine-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 7-chlorosulfonyl-2,3-dihydro-1,4-benzoxazine-4-carboxylate (CAS 1955540-74-5) is a chemical compound with the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. IUPAC name: tert-butyl 7-chlorosulfonyl-2,3-dihydro-1,4-benzoxazine-4-carboxylate. InChIKey: LHPRGZUITFAKOY-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO5S |
|---|---|
| Molecular weight | 333.79 g/mol |
| IUPAC name | tert-butyl 7-chlorosulfonyl-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| InChIKey | LHPRGZUITFAKOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C1C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)