CAS 1955547-21-3 is the registry number for 4-Bromo-5,6,7,8-tetrahydro-1,7-naphthyridine dihydrobromide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-5,6,7,8-tetrahydro-1,7-naphthyridine;dihydrobromide (CAS 1955547-21-3) is a chemical compound with the molecular formula C8H11Br3N2 and a molecular weight of 374.90 g/mol. IUPAC name: 4-bromo-5,6,7,8-tetrahydro-1,7-naphthyridine;dihydrobromide. InChIKey: JCWUXUGLBBLKFZ-UHFFFAOYSA-N.
| Molecular formula | C8H11Br3N2 |
|---|---|
| Molecular weight | 374.90 g/mol |
| IUPAC name | 4-bromo-5,6,7,8-tetrahydro-1,7-naphthyridine;dihydrobromide |
| InChIKey | JCWUXUGLBBLKFZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=NC=CC(=C21)Br.Br.Br |
Computed by PubChem (NCBI)