CAS 1955548-76-1 appears in our catalog under these names: 7,7-Difluoro-2-oxabicyclo(4.1.0)heptane-1-carboxylic acid, 98%, 7,7-Difluoro-2-oxabicyclo(4.1.0)heptane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
7,7-difluoro-2-oxabicyclo[4.1.0]heptane-1-carboxylic acid (CAS 1955548-76-1) is a chemical compound with the molecular formula C7H8F2O3 and a molecular weight of 178.13 g/mol. IUPAC name: 7,7-difluoro-2-oxabicyclo[4.1.0]heptane-1-carboxylic acid. InChIKey: UDPRWNCDCYXBRH-UHFFFAOYSA-N.
| Molecular formula | C7H8F2O3 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 7,7-difluoro-2-oxabicyclo[4.1.0]heptane-1-carboxylic acid |
| InChIKey | UDPRWNCDCYXBRH-UHFFFAOYSA-N |
| SMILES | C1CC2C(C2(F)F)(OC1)C(=O)O |
Computed by PubChem (NCBI)