CAS 1955554-10-5 appears in our catalog under these names: (6-(2,2,2-Trifluoroethoxy)pyridazin-3-yl)methanamine dihydrochloride, 98%, (6-(2,2,2-Trifluoroethoxy)pyridazin-3-yl)methanamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine;dihydrochloride (CAS 1955554-10-5) is a chemical compound with the molecular formula C7H10Cl2F3N3O and a molecular weight of 280.07 g/mol. IUPAC name: [6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine;dihydrochloride. InChIKey: QTSNFJSHKJTKNE-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2F3N3O |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | [6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methanamine;dihydrochloride |
| InChIKey | QTSNFJSHKJTKNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN=C1CN)OCC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)