Products 1955556-73-6

CAS 1955556-73-6 is the registry number for 1-(Azetidin-3-yl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(azetidin-3-yl)triazole-4-carboxylic acid;hydrochloride (CAS 1955556-73-6) is a chemical compound with the molecular formula C6H9ClN4O2 and a molecular weight of 204.61 g/mol. IUPAC name: 1-(azetidin-3-yl)triazole-4-carboxylic acid;hydrochloride. InChIKey: JRTPZIFRNZLEPS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN4O2
Molecular weight204.61 g/mol
IUPAC name1-(azetidin-3-yl)triazole-4-carboxylic acid;hydrochloride
InChIKeyJRTPZIFRNZLEPS-UHFFFAOYSA-N
SMILESC1C(CN1)N2C=C(N=N2)C(=O)O.Cl

Computed by PubChem (NCBI)