CAS 1955561-12-2 is the registry number for Methyl 4-(fluorosulfonyl)-3-methoxybenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-fluorosulfonyl-3-methoxybenzoate (CAS 1955561-12-2) is a chemical compound with the molecular formula C9H9FO5S and a molecular weight of 248.23 g/mol. IUPAC name: methyl 4-fluorosulfonyl-3-methoxybenzoate. InChIKey: GUSCJDYKCJKQBW-UHFFFAOYSA-N.
| Molecular formula | C9H9FO5S |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | methyl 4-fluorosulfonyl-3-methoxybenzoate |
| InChIKey | GUSCJDYKCJKQBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)S(=O)(=O)F |
Computed by PubChem (NCBI)