CAS 1955564-13-2 is the registry number for (2E)-1-(Difluoromethyl)-2-(1-nitrosoethylidene)-2,3-dihydro-1h-1,3-benzodiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylidene]hydroxylamine (CAS 1955564-13-2) is a chemical compound with the molecular formula C10H9F2N3O and a molecular weight of 225.19 g/mol. IUPAC name: (NE)-N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylidene]hydroxylamine. InChIKey: ZTLFPGJLKZIUIH-MKMNVTDBSA-N.
| Molecular formula | C10H9F2N3O |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | (NE)-N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylidene]hydroxylamine |
| InChIKey | ZTLFPGJLKZIUIH-MKMNVTDBSA-N |
| SMILES | C/C(=N\O)/C1=NC2=CC=CC=C2N1C(F)F |
Computed by PubChem (NCBI)