Products 195604-21-8
CAS 195604-21-8 is the registry number for DN-108. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-1-phenylcyclopropane-1-carboxamide (CAS 195604-21-8) is a chemical compound with the molecular formula C20H18N2O3S and a molecular weight of 366.4 g/mol. IUPAC name: N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-1-phenylcyclopropane-1-carboxamide. InChIKey: FTRMOJIRMFXZJV-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O3S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-1-phenylcyclopropane-1-carboxamide |
| InChIKey | FTRMOJIRMFXZJV-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)