CAS 1956318-08-3 is the registry number for Ethyl 3-iodo-6-oxo-6,7-dihydrothieno[2,3-b]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 3-iodo-6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate (CAS 1956318-08-3) is a chemical compound with the molecular formula C10H8INO3S and a molecular weight of 349.15 g/mol. IUPAC name: ethyl 3-iodo-6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate. InChIKey: MCRJORGESLJEQZ-UHFFFAOYSA-N.
| Molecular formula | C10H8INO3S |
|---|---|
| Molecular weight | 349.15 g/mol |
| IUPAC name | ethyl 3-iodo-6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | MCRJORGESLJEQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)NC(=O)C=C2)I |
Computed by PubChem (NCBI)