CAS 1956318-54-9 appears in our catalog under these names: 2–(Bromomethyl)–3–(trifluoromethyl)pyridine hydrobromide, 2-(Bromomethyl)-3-(trifluoromethyl)pyridine hydrobromide, 95%, 95%, 2-(BROMOMETHYL)-3-(TRIFLUOROMETHYL)PYRIDINE HYDROBROMIDE, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(bromomethyl)-3-(trifluoromethyl)pyridine;hydrobromide (CAS 1956318-54-9) is a chemical compound with the molecular formula C7H6Br2F3N and a molecular weight of 320.93 g/mol. IUPAC name: 2-(bromomethyl)-3-(trifluoromethyl)pyridine;hydrobromide. InChIKey: PYLGKFVGHGFUTF-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2F3N |
|---|---|
| Molecular weight | 320.93 g/mol |
| IUPAC name | 2-(bromomethyl)-3-(trifluoromethyl)pyridine;hydrobromide |
| InChIKey | PYLGKFVGHGFUTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CBr)C(F)(F)F.Br |
Computed by PubChem (NCBI)