CAS 1956322-63-6 is the registry number for 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (CAS 1956322-63-6) is a chemical compound with the molecular formula C11H8FN5 and a molecular weight of 229.21 g/mol. IUPAC name: 5-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine. InChIKey: OCJJCWTUCKXECP-UHFFFAOYSA-N.
| Molecular formula | C11H8FN5 |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| InChIKey | OCJJCWTUCKXECP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CN=CC3=NC(=NN23)N |
Computed by PubChem (NCBI)