CAS 1956325-14-6 appears in our catalog under these names: 5-Bromo-2-chloro-6-fluorobenzo(d)thiazole, 97%, 5-Bromo-2-chloro-6-fluorobenzo(D)thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
5-bromo-2-chloro-6-fluoro-1,3-benzothiazole (CAS 1956325-14-6) is a chemical compound with the molecular formula C7H2BrClFNS and a molecular weight of 266.52 g/mol. IUPAC name: 5-bromo-2-chloro-6-fluoro-1,3-benzothiazole. InChIKey: GXGNSXRGBXCRSI-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFNS |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 5-bromo-2-chloro-6-fluoro-1,3-benzothiazole |
| InChIKey | GXGNSXRGBXCRSI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)SC(=N2)Cl |
Computed by PubChem (NCBI)