CAS 1956325-28-2 is the registry number for Ethyl 5-bromo-7-fluoro-2-naphthoate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
Ethyl 5-bromo-7-fluoronaphthalene-2-carboxylate (CAS 1956325-28-2) is a chemical compound with the molecular formula C13H10BrFO2 and a molecular weight of 297.12 g/mol. IUPAC name: ethyl 5-bromo-7-fluoronaphthalene-2-carboxylate. InChIKey: QXBFINWSSFIRIJ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO2 |
|---|---|
| Molecular weight | 297.12 g/mol |
| IUPAC name | ethyl 5-bromo-7-fluoronaphthalene-2-carboxylate |
| InChIKey | QXBFINWSSFIRIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2C=C1)Br)F |
Computed by PubChem (NCBI)