Products 1956325-28-2

CAS 1956325-28-2 is the registry number for Ethyl 5-bromo-7-fluoro-2-naphthoate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-7-fluoronaphthalene-2-carboxylate (CAS 1956325-28-2) is a chemical compound with the molecular formula C13H10BrFO2 and a molecular weight of 297.12 g/mol. IUPAC name: ethyl 5-bromo-7-fluoronaphthalene-2-carboxylate. InChIKey: QXBFINWSSFIRIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BrFO2
Molecular weight297.12 g/mol
IUPAC nameethyl 5-bromo-7-fluoronaphthalene-2-carboxylate
InChIKeyQXBFINWSSFIRIJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=CC(=CC(=C2C=C1)Br)F

Computed by PubChem (NCBI)