Products 1956356-33-4

CAS 1956356-33-4 is the registry number for 1-(Azetidin-3-yl)-4-(pyridin-2-yl)piperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(azetidin-3-yl)-4-pyridin-2-ylpiperazine;dihydrochloride (CAS 1956356-33-4) is a chemical compound with the molecular formula C12H20Cl2N4 and a molecular weight of 291.22 g/mol. IUPAC name: 1-(azetidin-3-yl)-4-pyridin-2-ylpiperazine;dihydrochloride. InChIKey: VZQHAFYCUJNSER-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20Cl2N4
Molecular weight291.22 g/mol
IUPAC name1-(azetidin-3-yl)-4-pyridin-2-ylpiperazine;dihydrochloride
InChIKeyVZQHAFYCUJNSER-UHFFFAOYSA-N
SMILESC1CN(CCN1C2CNC2)C3=CC=CC=N3.Cl.Cl

Computed by PubChem (NCBI)