Products 1956364-92-3
CAS 1956364-92-3 is the registry number for 7-Chloro-3-iodo-1-tosyl-1h-pyrrolo[2,3-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridine (CAS 1956364-92-3) is a chemical compound with the molecular formula C14H10ClIN2O2S and a molecular weight of 432.7 g/mol. IUPAC name: 7-chloro-3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridine. InChIKey: XFSLPQUJCAJXKP-UHFFFAOYSA-N.
| Molecular formula | C14H10ClIN2O2S |
|---|---|
| Molecular weight | 432.7 g/mol |
| IUPAC name | 7-chloro-3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridine |
| InChIKey | XFSLPQUJCAJXKP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C(=NC=C3)Cl)I |
Computed by PubChem (NCBI)