CAS 1956365-26-6 is the registry number for tert-Butyl 5-(bromomethyl)-2,2-dimethyloxazolidine-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 5-(bromomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 1956365-26-6) is a chemical compound with the molecular formula C11H20BrNO3 and a molecular weight of 294.19 g/mol. IUPAC name: tert-butyl 5-(bromomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: JHKBXTJHHHNYQM-UHFFFAOYSA-N.
| Molecular formula | C11H20BrNO3 |
|---|---|
| Molecular weight | 294.19 g/mol |
| IUPAC name | tert-butyl 5-(bromomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | JHKBXTJHHHNYQM-UHFFFAOYSA-N |
| SMILES | CC1(N(CC(O1)CBr)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)