Products 1956367-34-2

CAS 1956367-34-2 is the registry number for 7-Chloro-1-((tetrahydro-2H-pyran-4-yl)methyl)-1H-indole-3-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.

Structural formula: {0} (CAS {1})

7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride (CAS 1956367-34-2) is a chemical compound with the molecular formula C15H15Cl2NO2 and a molecular weight of 312.2 g/mol. IUPAC name: 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride. InChIKey: HZSOTAASSFDJNM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15Cl2NO2
Molecular weight312.2 g/mol
IUPAC name7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride
InChIKeyHZSOTAASSFDJNM-UHFFFAOYSA-N
SMILESC1COCCC1CN2C=C(C3=C2C(=CC=C3)Cl)C(=O)Cl

Computed by PubChem (NCBI)