CAS 1956367-34-2 is the registry number for 7-Chloro-1-((tetrahydro-2H-pyran-4-yl)methyl)-1H-indole-3-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride (CAS 1956367-34-2) is a chemical compound with the molecular formula C15H15Cl2NO2 and a molecular weight of 312.2 g/mol. IUPAC name: 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride. InChIKey: HZSOTAASSFDJNM-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl2NO2 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 7-chloro-1-(oxan-4-ylmethyl)indole-3-carbonyl chloride |
| InChIKey | HZSOTAASSFDJNM-UHFFFAOYSA-N |
| SMILES | C1COCCC1CN2C=C(C3=C2C(=CC=C3)Cl)C(=O)Cl |
Computed by PubChem (NCBI)