CAS 1956376-42-3 is the registry number for 6-Chloro-3-(3,3,3-trifluoropropyl)-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-chloro-3-(3,3,3-trifluoropropyl)-2H-indazole (CAS 1956376-42-3) is a chemical compound with the molecular formula C10H8ClF3N2 and a molecular weight of 248.63 g/mol. IUPAC name: 6-chloro-3-(3,3,3-trifluoropropyl)-2H-indazole. InChIKey: AHVSUSNJEQIEDG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3N2 |
|---|---|
| Molecular weight | 248.63 g/mol |
| IUPAC name | 6-chloro-3-(3,3,3-trifluoropropyl)-2H-indazole |
| InChIKey | AHVSUSNJEQIEDG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1Cl)CCC(F)(F)F |
Computed by PubChem (NCBI)